cas: 1415960-54-1 — see every product listed under this CAS number, including other names
Benzeneaceticacid,2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-,methylester, 97%, 97% (CAS 1415960-54-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EN62-1g |
| cas | 1415960-54-1 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1864.40 Pln | |
| Chemat | 50mg | 285.20 Pln | |
| Chemat | 100mg | 357.20 Pln | |
| Chemat | 250mg | 525.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate (CAS 1415960-54-1) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: methyl 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate. InChIKey: RMCPHBITAFLGEA-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | methyl 2-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate |
| InChIKey | RMCPHBITAFLGEA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CC(=O)OC)C |
Computed by PubChem (NCBI)