cas: 64265-77-6 — see every product listed under this CAS number, including other names
Benzenemethanamine, 4-bromo-α-methyl-, hydrochloride (1:1), (αR)-, 95%, 95% (CAS 64265-77-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C81-250mg |
| cas | 64265-77-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 25g | 1533.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(4-bromophenyl)ethanamine;hydrochloride (CAS 64265-77-6) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1R)-1-(4-bromophenyl)ethanamine;hydrochloride. InChIKey: BQCAANUXMMQVAY-FYZOBXCZSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1R)-1-(4-bromophenyl)ethanamine;hydrochloride |
| InChIKey | BQCAANUXMMQVAY-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC=C(C=C1)Br)N.Cl |
Computed by PubChem (NCBI)