cas: 82398-30-9 — see every product listed under this CAS number, including other names
Benzenemethanamine,a-methyl-N-[(1R)-1-phenylethyl]-,hydrochloride (1:1), (aR)-, 98%, 98% (CAS 82398-30-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147FE-250mg |
| cas | 82398-30-9 |
| size | 250mg |
| availability | 400g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 366.80 Pln | |
| Chemat | 25g | 789.20 Pln | |
| Chemat | 100g | 2483.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride (CAS 82398-30-9) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride. InChIKey: ZBQCLJZOKDRAOW-DTPOWOMPSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride |
| InChIKey | ZBQCLJZOKDRAOW-DTPOWOMPSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N[C@H](C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)