CAS 82398-30-9 appears in our catalog under these names: (R,R)-(+)-Bis(alpha-methylbenzyl)amine hydrochloride, 98%, (R,R)–(+)–Bis(α–methylbenzyl)amine Hydrochloride, (R,R)-(+)-Bis(alpha-methylbenzyl)amine Hydrochloride, >98.0%(HPLC)(T), (R,R)-Bis(alpha-methylbenzyl)amine Hydrochloride 98%, Benzenemethanamine,a-methyl-N-[(1R)-1-phenylethyl]-,hydrochloride (1:1), (aR)-, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100g, 500g.
(1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride (CAS 82398-30-9) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride. InChIKey: ZBQCLJZOKDRAOW-DTPOWOMPSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride |
| InChIKey | ZBQCLJZOKDRAOW-DTPOWOMPSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N[C@H](C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)