Products 1171447-32-7
CAS 1171447-32-7 appears in our catalog under these names: 4'-tert-Butyl-1,1'-biphenyl-3-amine hydrochloride, 95%, 3-(4-tert-Butylphenyl)aniline hydrochloride, 95%, 3-(4-tert-Butylphenyl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g.
3-(4-tert-butylphenyl)aniline;hydrochloride (CAS 1171447-32-7) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: 3-(4-tert-butylphenyl)aniline;hydrochloride. InChIKey: ZKUQYOCUNPLZQU-UHFFFAOYSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)aniline;hydrochloride |
| InChIKey | ZKUQYOCUNPLZQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC(=CC=C2)N.Cl |
Computed by PubChem (NCBI)