cas: 82398-30-9 — see every product listed under this CAS number, including other names
(R,R)-Bis-1-phenylethyl)amine hydrochloride, 95% (CAS 82398-30-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224455-250MG |
| cas | 82398-30-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 263.47 Pln | |
| Fluorochem | 10g | 476.93 Pln | |
| Fluorochem | 25g | 1091.30 Pln | |
| Fluorochem | 100g | 3163.49 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride (CAS 82398-30-9) is a chemical compound with the molecular formula C16H20ClN and a molecular weight of 261.79 g/mol. IUPAC name: (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride. InChIKey: ZBQCLJZOKDRAOW-DTPOWOMPSA-N.
| Molecular formula | C16H20ClN |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine;hydrochloride |
| InChIKey | ZBQCLJZOKDRAOW-DTPOWOMPSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N[C@H](C)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)