cas: 867256-77-7 — see every product listed under this CAS number, including other names
Benzoic acid, 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 95%, 95% (CAS 867256-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115NG8-100mg |
| cas | 867256-77-7 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 602.00 Pln | |
| Chemat | 25g | 1384.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 867256-77-7) is a chemical compound with the molecular formula C13H16BFO4 and a molecular weight of 266.07 g/mol. IUPAC name: 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: BZWWFDHWZHGLFH-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO4 |
|---|---|
| Molecular weight | 266.07 g/mol |
| IUPAC name | 2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | BZWWFDHWZHGLFH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)O)F |
Computed by PubChem (NCBI)