CAS 936728-22-2 appears in our catalog under these names: 3-Carboxy-5-fluorobenzeneboronic acid pinacol ester, 96% , 3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%, 98%, 3-Fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98%. Offered by: Thermo Scientific (Alfa Aesar), Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g, 25g, 10g.
3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 936728-22-2) is a chemical compound with the molecular formula C13H16BFO4 and a molecular weight of 266.07 g/mol. IUPAC name: 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: NMYIHYHALOHVHV-UHFFFAOYSA-N.
| Molecular formula | C13H16BFO4 |
|---|---|
| Molecular weight | 266.07 g/mol |
| IUPAC name | 3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | NMYIHYHALOHVHV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)C(=O)O |
Computed by PubChem (NCBI)