cas: 1486-53-9 — see every product listed under this CAS number, including other names
Benzoic acid, 3-methoxy-4-(phenylmethoxy)-, 98%, 98% (CAS 1486-53-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112L3Z-1g |
| cas | 1486-53-9 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 100g | 1221.20 Pln | |
| Chemat | 50g | 645.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methoxy-4-phenylmethoxybenzoic acid (CAS 1486-53-9) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. IUPAC name: 3-methoxy-4-phenylmethoxybenzoic acid. InChIKey: JGMBQAGNZLBZCE-UHFFFAOYSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 3-methoxy-4-phenylmethoxybenzoic acid |
| InChIKey | JGMBQAGNZLBZCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)