Products 63057-70-5
CAS 63057-70-5 is the registry number for 4–(benzyloxy)–5–Methoxycyclohexa–1，3–dienecarboxylic acid. Offered by: GLPBio. Available pack sizes: 200mg.
3-methoxy-4-phenylmethoxy(13C)benzoic acid (CAS 63057-70-5) is a chemical compound with the molecular formula C15H14O4 and a molecular weight of 259.26 g/mol. IUPAC name: 3-methoxy-4-phenylmethoxy(13C)benzoic acid. InChIKey: JGMBQAGNZLBZCE-XPOOIHDOSA-N.
| Molecular formula | C15H14O4 |
|---|---|
| Molecular weight | 259.26 g/mol |
| IUPAC name | 3-methoxy-4-phenylmethoxy(13C)benzoic acid |
| InChIKey | JGMBQAGNZLBZCE-XPOOIHDOSA-N |
| SMILES | COC1=C(C=CC(=C1)[13C](=O)O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)