cas: 790695-49-7 — see every product listed under this CAS number, including other names
Benzoic acid, 4-hydroxy-2-(trifluoromethyl)-, methyl ester, 96%, 96% (CAS 790695-49-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ID10-250mg |
| cas | 790695-49-7 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1749.20 Pln | |
| Chemat | 10g | 3179.60 Pln | |
| Chemat | 25g | 6299.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-hydroxy-2-(trifluoromethyl)benzoate (CAS 790695-49-7) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: methyl 4-hydroxy-2-(trifluoromethyl)benzoate. InChIKey: OLSWKTCQCZAEOW-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | methyl 4-hydroxy-2-(trifluoromethyl)benzoate |
| InChIKey | OLSWKTCQCZAEOW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)O)C(F)(F)F |
Computed by PubChem (NCBI)