cas: 5607-64-7 — see every product listed under this CAS number, including other names
Benzoyl chloride, 4-chloro-2-methoxy-, 95%+, 95%+ (CAS 5607-64-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12GH57-100mg |
| cas | 5607-64-7 |
| size | 100mg |
| availability | 1.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 424.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
4-chloro-2-methoxybenzoyl chloride (CAS 5607-64-7) is a chemical compound with the molecular formula C8H6Cl2O2 and a molecular weight of 205.03 g/mol. IUPAC name: 4-chloro-2-methoxybenzoyl chloride. InChIKey: OKEFBVALFLRAFV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O2 |
|---|---|
| Molecular weight | 205.03 g/mol |
| IUPAC name | 4-chloro-2-methoxybenzoyl chloride |
| InChIKey | OKEFBVALFLRAFV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)Cl)C(=O)Cl |
Computed by PubChem (NCBI)