Benzoylchloride-4-boronic acid
cas: 332154-57-1 — see every product listed under this CAS number, including other names
Benzoylchloride-4-boronic acid (CAS 332154-57-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 200mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036908-10G |
| cas | 332154-57-1 |
| size | 10g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 1205.84 Pln | |
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 200mg | 190.58 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 737.26 Pln |
properties
| delivery time | 3-4 weeks |
|---|
(4-carbonochloridoylphenyl)boronic acid (CAS 332154-57-1) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (4-carbonochloridoylphenyl)boronic acid. InChIKey: ARKQVAQLGLIPAU-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (4-carbonochloridoylphenyl)boronic acid |
| InChIKey | ARKQVAQLGLIPAU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Chlorocarbonylphenylboronic acid, Benzoylchloride-4-boronic acid, (4-(Chlorocarbonyl)phenyl)boronic acid, (4-Chlorocarbonylphenyl)Boronic Anhydride, 4-Chlorocarbonylphenylboronic boronic acid, (4-carbonochloridoylphenyl)boronic acid, 4-(chlorocarbonyl)phenylboronic acid, [4-(Chlorocarbonyl)phenyl]boronic acid, Boronic acid, B-[4-(chlorocarbonyl)phenyl]-, p-chlorocarbonylphenylboronic acid