Products 332154-58-2
CAS 332154-58-2 appears in our catalog under these names: 3-Boronobenzoyl chloride, 90%, 3-Chlorocarbonylphenylboronic acid, 90%, (3-(Chlorocarbonyl)phenyl)boronic acid, 98%, (3-(Chlorocarbonyl)phenyl)boronic acid 90%, 3-Chlorocarbonylphenylboronic acid, 90%, 90%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 25g, 1g, 250mg, 10g.
(3-carbonochloridoylphenyl)boronic acid (CAS 332154-58-2) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (3-carbonochloridoylphenyl)boronic acid. InChIKey: AIHGXUQQIIYAJP-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (3-carbonochloridoylphenyl)boronic acid |
| InChIKey | AIHGXUQQIIYAJP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)Cl)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Chlorocarbonylphenylboronic Acid, (3-(Chlorocarbonyl)phenyl)boronic acid, Benzoylchloride-3-boronic acid, (3-carbonochloridoylphenyl)boronic acid, (3-chlorocarbonylphenyl)boronic acid, [3-(Chlorocarbonyl)phenyl]boronic acid, 3-(Chlorocarbonyl)phenylboronic Acid, [3-(carbonochloridoyl)phenyl]boronic acid, Boronic acid, [3-(chlorocarbonyl)phenyl]- (9CI), (3-(Chlorocarbonyl)phenyl)boronicacid