Products 928048-11-7
CAS 928048-11-7 appears in our catalog under these names: 3-Chloro-2-formylphenylboronic acid, 95%, (3-Chloro-2-formylphenyl)boronic acid 98%, (3-Chloro-2-forMylphenyl)boronic acid, 98%, 98%, (3-Chloro-2-formylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(3-chloro-2-formylphenyl)boronic acid (CAS 928048-11-7) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (3-chloro-2-formylphenyl)boronic acid. InChIKey: NYANPLLJDXQXPC-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (3-chloro-2-formylphenyl)boronic acid |
| InChIKey | NYANPLLJDXQXPC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)Cl)C=O)(O)O |
Computed by PubChem (NCBI)