CAS 1072952-53-4 appears in our catalog under these names: 3–Chloro–4–Formylphenylboronic Acid, 3-Chloro-4-formylphenylboronic acid, 96%, (3-Chloro-4-formylphenyl)boronic acid 98%, 3-Chloro-4-formylphenylboronic acid, 98%, 98%, (3-Chloro-4-formylphenyl)boronic acid, 97%. Offered by: GLPBio, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 5g, 100mg.
(3-chloro-4-formylphenyl)boronic acid (CAS 1072952-53-4) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (3-chloro-4-formylphenyl)boronic acid. InChIKey: KDIYVLXLPNHJRZ-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (3-chloro-4-formylphenyl)boronic acid |
| InChIKey | KDIYVLXLPNHJRZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)Cl)(O)O |
Computed by PubChem (NCBI)