cas: 2460255-78-9 — see every product listed under this CAS number, including other names
Benzyl (1-(tert-butyl)-3-(3-oxocyclopentyl)-1H-pyrazol-5-yl)carbamate, 95% (CAS 2460255-78-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1633097-100mg |
| cas | 2460255-78-9 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 264.69 Pln | |
| Ambeed | 250mg | 392.62 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1634.00 Pln | |
| BLDpharm | 100mg | 281.04 Pln | |
| BLDpharm | 250mg | 419.88 Pln | |
| BLDpharm | 1g | 847.50 Pln | |
| BLDpharm | 5g | 2396.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Benzyl N-[1-tert-butyl-3-(3-oxocyclopentyl)pyrazol-5-yl]carbamate (CAS 2460255-78-9) is a chemical compound with the molecular formula C20H25N3O3 and a molecular weight of 355.4 g/mol. IUPAC name: benzyl N-[1-tert-butyl-3-(3-oxocyclopentyl)pyrazol-5-yl]carbamate. InChIKey: PCMHACWNZMLJQH-UHFFFAOYSA-N.
| Molecular formula | C20H25N3O3 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | benzyl N-[1-tert-butyl-3-(3-oxocyclopentyl)pyrazol-5-yl]carbamate |
| InChIKey | PCMHACWNZMLJQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=CC(=N1)C2CCC(=O)C2)NC(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)