cas: 50850-19-6 — see every product listed under this CAS number, including other names
Benzyl (2-amino-2-iminoethyl)carbamate hydrochloride 97% (CAS 50850-19-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208070-250mg |
| cas | 50850-19-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 1037.88 Pln | |
| Ambeed | 25g | 3107.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A208070 |
Benzyl N-(2-amino-2-iminoethyl)carbamate;hydrochloride (CAS 50850-19-6) is a chemical compound with the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. IUPAC name: benzyl N-(2-amino-2-iminoethyl)carbamate;hydrochloride. InChIKey: VTAFRBUDWDYKSA-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN3O2 |
|---|---|
| Molecular weight | 243.69 g/mol |
| IUPAC name | benzyl N-(2-amino-2-iminoethyl)carbamate;hydrochloride |
| InChIKey | VTAFRBUDWDYKSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCC(=N)N.Cl |
Computed by PubChem (NCBI)