cas: 92159-87-0 — see every product listed under this CAS number, including other names
Benzyl (4-bromophenyl)carbamate, 98%, 98% (CAS 92159-87-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IH28-100mg |
| cas | 92159-87-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 419.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(4-bromophenyl)carbamate (CAS 92159-87-0) is a chemical compound with the molecular formula C14H12BrNO2 and a molecular weight of 306.15 g/mol. IUPAC name: benzyl N-(4-bromophenyl)carbamate. InChIKey: OGIRMVQVHNCXEH-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2 |
|---|---|
| Molecular weight | 306.15 g/mol |
| IUPAC name | benzyl N-(4-bromophenyl)carbamate |
| InChIKey | OGIRMVQVHNCXEH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)