cas: 98648-05-6 — see every product listed under this CAS number, including other names
Benzyl (6-oxohexyl)carbamate, 97%, 97% (CAS 98648-05-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IK6K-250mg |
| cas | 98648-05-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 318.80 Pln | |
| Chemat | 5g | 1000.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(6-oxohexyl)carbamate (CAS 98648-05-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl N-(6-oxohexyl)carbamate. InChIKey: XPGMGPSEWHRDSL-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl N-(6-oxohexyl)carbamate |
| InChIKey | XPGMGPSEWHRDSL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCCCC=O |
Computed by PubChem (NCBI)