CAS 915921-64-1 is the registry number for 3-[(3,3-Dimethylbutanoyl)amino]-4-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid (CAS 915921-64-1) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid. InChIKey: IQZBVCIRKSIHQY-UHFFFAOYSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | 3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid |
| InChIKey | IQZBVCIRKSIHQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)CC(C)(C)C |
Computed by PubChem (NCBI)