Products 915921-64-1

CAS 915921-64-1 is the registry number for 3-[(3,3-Dimethylbutanoyl)amino]-4-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid (CAS 915921-64-1) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: 3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid. InChIKey: IQZBVCIRKSIHQY-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO3
Molecular weight249.30 g/mol
IUPAC name3-(3,3-dimethylbutanoylamino)-4-methylbenzoic acid
InChIKeyIQZBVCIRKSIHQY-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C(=O)O)NC(=O)CC(C)(C)C

Computed by PubChem (NCBI)