cas: 1403766-86-8 — see every product listed under this CAS number, including other names
Benzyl (cis-3-hydroxycyclobutyl)carbamate 98% (CAS 1403766-86-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A340714-1g |
| cas | 1403766-86-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 793.12 Pln | |
| Ambeed | 25g | 2990.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A340714 |
Benzyl N-(3-hydroxycyclobutyl)carbamate (CAS 1403766-86-8) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: benzyl N-(3-hydroxycyclobutyl)carbamate. InChIKey: BCFMGQOQYWGLIL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | benzyl N-(3-hydroxycyclobutyl)carbamate |
| InChIKey | BCFMGQOQYWGLIL-UHFFFAOYSA-N |
| SMILES | C1C(CC1O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)