cas: 1403766-86-8 — see every product listed under this CAS number, including other names
cis-Benzyl 3-hydroxycyclobutylcarbamate, 99.62% (CAS 1403766-86-8) is a chemical reagent available from Chemat. Available pack sizes: 50 g, 100 g, 25 g, 1 g, 5 g, 10 g, 500 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W057811-50 g |
| cas | 1403766-86-8 |
| size | 50 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 50 g | 6835.22 Pln | |
| MedChemExpress | 100 g | 11683.56 Pln | |
| MedChemExpress | 25 g | 3811.98 Pln | |
| MedChemExpress | 1 g | 477.59 Pln | |
| MedChemExpress | 5 g | 983.78 Pln | |
| MedChemExpress | 10 g | 1726.82 Pln | |
| MedChemExpress | 500 mg | 361.49 Pln | |
| MedChemExpress | 250 mg | 273.25 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.62% |
Benzyl N-(3-hydroxycyclobutyl)carbamate (CAS 1403766-86-8) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: benzyl N-(3-hydroxycyclobutyl)carbamate. InChIKey: BCFMGQOQYWGLIL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | benzyl N-(3-hydroxycyclobutyl)carbamate |
| InChIKey | BCFMGQOQYWGLIL-UHFFFAOYSA-N |
| SMILES | C1C(CC1O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)