cas: 1403766-86-8 — see every product listed under this CAS number, including other names
Benzyl (cis-3-hydroxycyclobutyl)carbamate, 98%, 98% (CAS 1403766-86-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CB1-100mg |
| cas | 1403766-86-8 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 500mg | 155.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 640.40 Pln | |
| Chemat | 10g | 1134.80 Pln | |
| Chemat | 25g | 2478.80 Pln | |
| Chemat | 50g | 4648.40 Pln | |
| Chemat | 100g | 7624.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-(3-hydroxycyclobutyl)carbamate (CAS 1403766-86-8) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: benzyl N-(3-hydroxycyclobutyl)carbamate. InChIKey: BCFMGQOQYWGLIL-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | benzyl N-(3-hydroxycyclobutyl)carbamate |
| InChIKey | BCFMGQOQYWGLIL-UHFFFAOYSA-N |
| SMILES | C1C(CC1O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)