Products 6342-19-4

CAS 6342-19-4 is the registry number for Morpholin-4-yl-phenyl-acetic acid, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g, 500mg.

Structural formula: {0} (CAS {1})

2-morpholin-4-yl-2-phenylacetic acid (CAS 6342-19-4) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 2-morpholin-4-yl-2-phenylacetic acid. InChIKey: OZJNQHRPTQSJDF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO3
Molecular weight221.25 g/mol
IUPAC name2-morpholin-4-yl-2-phenylacetic acid
InChIKeyOZJNQHRPTQSJDF-UHFFFAOYSA-N
SMILESC1COCCN1C(C2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)