cas: 1630906-94-3 — see every product listed under this CAS number, including other names
Benzyl 1-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate, 97%, 97% (CAS 1630906-94-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TQR-100mg |
| cas | 1630906-94-3 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 500mg | 952.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 1-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate (CAS 1630906-94-3) is a chemical compound with the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. IUPAC name: benzyl 1-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate. InChIKey: HYDIDLMVLFRIDJ-UHFFFAOYSA-N.
| Molecular formula | C17H22N2O3 |
|---|---|
| Molecular weight | 302.37 g/mol |
| IUPAC name | benzyl 1-oxo-2,9-diazaspiro[5.5]undecane-9-carboxylate |
| InChIKey | HYDIDLMVLFRIDJ-UHFFFAOYSA-N |
| SMILES | C1CC2(CCN(CC2)C(=O)OCC3=CC=CC=C3)C(=O)NC1 |
Computed by PubChem (NCBI)