cas: 97518-80-4 — see every product listed under this CAS number, including other names
Benzyl 2,2-dimethyl-3-oxopropanoate 95+% (CAS 97518-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1064081-100mg |
| cas | 97518-80-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 676.31 Pln | |
| Ambeed | 250mg | 1188.06 Pln | |
| Ambeed | 1g | 3424.19 Pln | |
| Ambeed | 5g | 13475.62 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1064081 |
Benzyl 2,2-dimethyl-3-oxopropanoate (CAS 97518-80-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: benzyl 2,2-dimethyl-3-oxopropanoate. InChIKey: GHICDGZYOXICST-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | benzyl 2,2-dimethyl-3-oxopropanoate |
| InChIKey | GHICDGZYOXICST-UHFFFAOYSA-N |
| SMILES | CC(C)(C=O)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)