Benzyl 2,2-dimethyl-3-oxopropanoate, 95+%
cas: 97518-80-4 — see every product listed under this CAS number, including other names
Benzyl 2,2-dimethyl-3-oxopropanoate, 95+% (CAS 97518-80-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1064081-100mg |
| cas | 97518-80-4 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 681.88 Pln | |
| Ambeed | 250mg | 1199.19 Pln | |
| Ambeed | 1g | 3457.56 Pln | |
| Ambeed | 5g | 13614.69 Pln | |
| Chemat | 100mg | 510.80 Pln | |
| Chemat | 250mg | 880.40 Pln | |
| Chemat | 500mg | 1547.60 Pln | |
| Chemat | 1g | 2522.00 Pln | |
| BLDpharm | 100mg | 730.88 Pln | |
| BLDpharm | 250mg | 1286.24 Pln | |
| BLDpharm | 1g | 3724.27 Pln | |
| BLDpharm | 5g | 14675.97 Pln | |
| Fluorochem | 100mg | 929.90 Pln | |
| Fluorochem | 250mg | 1637.98 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Benzyl 2,2-dimethyl-3-oxopropanoate (CAS 97518-80-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: benzyl 2,2-dimethyl-3-oxopropanoate. InChIKey: GHICDGZYOXICST-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | benzyl 2,2-dimethyl-3-oxopropanoate |
| InChIKey | GHICDGZYOXICST-UHFFFAOYSA-N |
| SMILES | CC(C)(C=O)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)