cas: 343319-03-9 — see every product listed under this CAS number, including other names
Benzyl 2-(tert-butylamino)acetate, 97+%, 97+% (CAS 343319-03-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118G7A-1g |
| cas | 343319-03-9 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 246.80 Pln |
| purity | 97+% |
|---|---|
| delivery time | 3 weeks |
Benzyl 2-(tert-butylamino)acetate (CAS 343319-03-9) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: benzyl 2-(tert-butylamino)acetate. InChIKey: WGJVYWVEWCTCHX-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | benzyl 2-(tert-butylamino)acetate |
| InChIKey | WGJVYWVEWCTCHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)