CAS 3129-92-8 is the registry number for Cyclohexylamine benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Benzoic acid;cyclohexanamine (CAS 3129-92-8) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: benzoic acid;cyclohexanamine. InChIKey: CIFYUXXXOJJPOL-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | benzoic acid;cyclohexanamine |
| InChIKey | CIFYUXXXOJJPOL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)N.C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)