CAS 79119-46-3 is the registry number for 4-hydroxy-N,N-bis(propan-2-yl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-hydroxy-N,N-di(propan-2-yl)benzamide (CAS 79119-46-3) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: 4-hydroxy-N,N-di(propan-2-yl)benzamide. InChIKey: YIJWBPAOJXIYJY-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | 4-hydroxy-N,N-di(propan-2-yl)benzamide |
| InChIKey | YIJWBPAOJXIYJY-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)