Products 7662-76-2
CAS 7662-76-2 appears in our catalog under these names: N-Benzylglycine tert-butyl ester, 98%, tert-Butyl benzylglycinate, 98%, tert–Butyl benzylglycinate, tert-Butyl benzylglycinate. Offered by: Combi-blocks, AmBeed, GLPBio, MedChemExpress. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 250 mg, 50 mg, 100 mg.
Tert-butyl 2-(benzylamino)acetate (CAS 7662-76-2) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: tert-butyl 2-(benzylamino)acetate. InChIKey: UURAHTSUPDIUNL-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | tert-butyl 2-(benzylamino)acetate |
| InChIKey | UURAHTSUPDIUNL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CNCC1=CC=CC=C1 |
Computed by PubChem (NCBI)
Synonyms:
Tert-butyl 2-(benzylamino)acetate, N-benzylglycine tert-butyl ester, tert-Butyl benzylglycinate, Benzylamino-acetic acid tert-butyl ester, N-benzylglycine t-butyl ester, (BENZYLAMINO)ACETIC ACID TERT-BUTYL ESTER, N-benzyl glycine t-butyl ester, tert-Butyl N-benzylaminoacetate, N-Benzylglycine Tert-Butylester, N-(benzyl)glycine-t-butyl ester