Benzyl 2-(tert-butylamino)acetate, 97+%
cas: 343319-03-9 — see every product listed under this CAS number, including other names
Benzyl 2-(tert-butylamino)acetate, 97+% (CAS 343319-03-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A728405-1g |
| cas | 343319-03-9 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 25g | 882.12 Pln | |
| Ambeed | 100g | 2689.94 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 100g | 3011.60 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 25g | 941.92 Pln | |
| BLDpharm | 100g | 2896.78 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 100g | 5584.51 Pln |
properties
| purity | 97+% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl 2-(tert-butylamino)acetate (CAS 343319-03-9) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: benzyl 2-(tert-butylamino)acetate. InChIKey: WGJVYWVEWCTCHX-UHFFFAOYSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | benzyl 2-(tert-butylamino)acetate |
| InChIKey | WGJVYWVEWCTCHX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)