cas: 444666-46-0 — see every product listed under this CAS number, including other names
Benzyl 2-methylpiperazine-1-carboxylate 95% (CAS 444666-46-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237575-250mg |
| cas | 444666-46-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1076.81 Pln | |
| Ambeed | 25g | 1883.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A237575 |
Benzyl 2-methylpiperazine-1-carboxylate (CAS 444666-46-0) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 2-methylpiperazine-1-carboxylate. InChIKey: KKBYAYOFCRJQQT-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl 2-methylpiperazine-1-carboxylate |
| InChIKey | KKBYAYOFCRJQQT-UHFFFAOYSA-N |
| SMILES | CC1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)