cas: 444666-46-0 — see every product listed under this CAS number, including other names
Benzyl 2-methylpiperazine-1-carboxylate (CAS 444666-46-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224344-250MG |
| cas | 444666-46-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 529.00 Pln |
| delivery time | 3-4 weeks |
|---|
Benzyl 2-methylpiperazine-1-carboxylate (CAS 444666-46-0) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 2-methylpiperazine-1-carboxylate. InChIKey: KKBYAYOFCRJQQT-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl 2-methylpiperazine-1-carboxylate |
| InChIKey | KKBYAYOFCRJQQT-UHFFFAOYSA-N |
| SMILES | CC1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)