cas: 444666-46-0 — see every product listed under this CAS number, including other names
Benzyl 2-methylpiperazine-1-carboxylate, 95%, 95% (CAS 444666-46-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D9SG-250mg |
| cas | 444666-46-0 |
| size | 250mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 698.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1557.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl 2-methylpiperazine-1-carboxylate (CAS 444666-46-0) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: benzyl 2-methylpiperazine-1-carboxylate. InChIKey: KKBYAYOFCRJQQT-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | benzyl 2-methylpiperazine-1-carboxylate |
| InChIKey | KKBYAYOFCRJQQT-UHFFFAOYSA-N |
| SMILES | CC1CNCCN1C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)