cas: 163457-22-5 — see every product listed under this CAS number, including other names
Benzyl 3,3-difluoropyrrolidine-1-carboxylate, 98%, 98% (CAS 163457-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112U61-100mg |
| cas | 163457-22-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 366.80 Pln | |
| Chemat | 1g | 837.20 Pln | |
| Chemat | 5g | 3309.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3,3-difluoropyrrolidine-1-carboxylate (CAS 163457-22-5) is a chemical compound with the molecular formula C12H13F2NO2 and a molecular weight of 241.23 g/mol. IUPAC name: benzyl 3,3-difluoropyrrolidine-1-carboxylate. InChIKey: XZMBERXRQLASNY-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO2 |
|---|---|
| Molecular weight | 241.23 g/mol |
| IUPAC name | benzyl 3,3-difluoropyrrolidine-1-carboxylate |
| InChIKey | XZMBERXRQLASNY-UHFFFAOYSA-N |
| SMILES | C1CN(CC1(F)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)