Products 1036495-26-7
CAS 1036495-26-7 is the registry number for N-Cyclopentyl-2,2-difluoro-2h-1,3-benzodioxol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
N-cyclopentyl-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 1036495-26-7) is a chemical compound with the molecular formula C12H13F2NO2 and a molecular weight of 241.23 g/mol. IUPAC name: N-cyclopentyl-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: YKHBXOHGLLFOQP-UHFFFAOYSA-N.
| Molecular formula | C12H13F2NO2 |
|---|---|
| Molecular weight | 241.23 g/mol |
| IUPAC name | N-cyclopentyl-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | YKHBXOHGLLFOQP-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)