Products 1593887-32-1

CAS 1593887-32-1 is the registry number for Methyl 2-(cyclobutylamino)-4,5-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 2-(cyclobutylamino)-4,5-difluorobenzoate (CAS 1593887-32-1) is a chemical compound with the molecular formula C12H13F2NO2 and a molecular weight of 241.23 g/mol. IUPAC name: methyl 2-(cyclobutylamino)-4,5-difluorobenzoate. InChIKey: KFVPFCCYAWVYBQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13F2NO2
Molecular weight241.23 g/mol
IUPAC namemethyl 2-(cyclobutylamino)-4,5-difluorobenzoate
InChIKeyKFVPFCCYAWVYBQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1NC2CCC2)F)F

Computed by PubChem (NCBI)