CAS 862284-30-8 is the registry number for (3S,4R)-4-(2,4-Difluorophenyl)-1-methylpyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-4-(2,4-difluorophenyl)-1-methylpyrrolidine-3-carboxylic acid (CAS 862284-30-8) is a chemical compound with the molecular formula C12H13F2NO2 and a molecular weight of 241.23 g/mol. IUPAC name: (3S,4R)-4-(2,4-difluorophenyl)-1-methylpyrrolidine-3-carboxylic acid. InChIKey: NNYAWTJAAXJTQP-VHSXEESVSA-N.
| Molecular formula | C12H13F2NO2 |
|---|---|
| Molecular weight | 241.23 g/mol |
| IUPAC name | (3S,4R)-4-(2,4-difluorophenyl)-1-methylpyrrolidine-3-carboxylic acid |
| InChIKey | NNYAWTJAAXJTQP-VHSXEESVSA-N |
| SMILES | CN1C[C@H]([C@@H](C1)C(=O)O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)