cas: 1228631-19-3 — see every product listed under this CAS number, including other names
Benzyl 3,5-dioxopiperidine-1-carboxylate, 97% (CAS 1228631-19-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A155122-100mg |
| cas | 1228631-19-3 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 1866.76 Pln | |
| AmBeed | 1g | 9971.71 Pln | |
| AmBeed | 5g | 30198.28 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl 3,5-dioxopiperidine-1-carboxylate (CAS 1228631-19-3) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: benzyl 3,5-dioxopiperidine-1-carboxylate. InChIKey: LWXKJIHFJCWJGM-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | benzyl 3,5-dioxopiperidine-1-carboxylate |
| InChIKey | LWXKJIHFJCWJGM-UHFFFAOYSA-N |
| SMILES | C1C(=O)CN(CC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)