CAS 55540-38-0 is the registry number for 4,5-Dimethoxy-2-(1h-pyrrol-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4,5-dimethoxy-2-pyrrol-1-ylbenzoic acid (CAS 55540-38-0) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 4,5-dimethoxy-2-pyrrol-1-ylbenzoic acid. InChIKey: POCCMFYSLDOPPP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4,5-dimethoxy-2-pyrrol-1-ylbenzoic acid |
| InChIKey | POCCMFYSLDOPPP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)N2C=CC=C2)OC |
Computed by PubChem (NCBI)