Products 36820-78-7
CAS 36820-78-7 is the registry number for Ethyl 3-formyl-5-methoxy-1H-indole-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 3-formyl-5-methoxy-1H-indole-2-carboxylate (CAS 36820-78-7) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: ethyl 3-formyl-5-methoxy-1H-indole-2-carboxylate. InChIKey: XQDZGHNVSBDTSP-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | ethyl 3-formyl-5-methoxy-1H-indole-2-carboxylate |
| InChIKey | XQDZGHNVSBDTSP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)C=CC(=C2)OC)C=O |
Computed by PubChem (NCBI)