Products 742120-03-2

CAS 742120-03-2 is the registry number for 2-[(3,5-Dimethylisoxazol-4-yl)methoxy]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid (CAS 742120-03-2) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid. InChIKey: YINROPPUXHDJPB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H13NO4
Molecular weight247.25 g/mol
IUPAC name2-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]benzoic acid
InChIKeyYINROPPUXHDJPB-UHFFFAOYSA-N
SMILESCC1=C(C(=NO1)C)COC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)