cas: 934665-23-3 — see every product listed under this CAS number, including other names
Benzyl 3-(([(tert-butoxy)carbonyl]amino)methyl)-3-hydroxyazetidine-1-carboxylate, 97%, 97% (CAS 934665-23-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKYP-100mg |
| cas | 934665-23-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 765.20 Pln | |
| Chemat | 500mg | 1235.60 Pln | |
| Chemat | 1g | 1826.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidine-1-carboxylate (CAS 934665-23-3) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: benzyl 3-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidine-1-carboxylate. InChIKey: AQRVFNPLGPHVGK-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | benzyl 3-hydroxy-3-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]azetidine-1-carboxylate |
| InChIKey | AQRVFNPLGPHVGK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CN(C1)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)