cas: 1801176-35-1 — see every product listed under this CAS number, including other names
Benzyl 3-(bromomethyl)cyclobutanecarboxylate, 97%, 97% (CAS 1801176-35-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I11A-100mg |
| cas | 1801176-35-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1230.80 Pln | |
| Chemat | 250mg | 2018.00 Pln | |
| Chemat | 500mg | 2848.40 Pln | |
| Chemat | 1g | 4043.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-(bromomethyl)cyclobutane-1-carboxylate (CAS 1801176-35-1) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: benzyl 3-(bromomethyl)cyclobutane-1-carboxylate. InChIKey: FWCABFRPKRKQID-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | benzyl 3-(bromomethyl)cyclobutane-1-carboxylate |
| InChIKey | FWCABFRPKRKQID-UHFFFAOYSA-N |
| SMILES | C1C(CC1C(=O)OCC2=CC=CC=C2)CBr |
Computed by PubChem (NCBI)