cas: 1175712-34-1 — see every product listed under this CAS number, including other names
Benzyl 3-(tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate, 95-<97% (CAS 1175712-34-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC5272-95-97-10g |
| cas | 1175712-34-1 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 4608.12 Pln | |
| Hoffman Fine Chemicals | 25g | 8908.24 Pln | |
| Hoffman Fine Chemicals | 50g | 14069.66 Pln | |
| Hoffman Fine Chemicals | 100g | 22319.00 Pln | |
| Hoffman Fine Chemicals | 200g | 37726.70 Pln | |
| Hoffman Fine Chemicals | 300g | 48017.64 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate (CAS 1175712-34-1) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate. InChIKey: PIVUWPMJVNUMBB-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | benzyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propanoate |
| InChIKey | PIVUWPMJVNUMBB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)