cas: 939759-25-8 — see every product listed under this CAS number, including other names
Benzyl 3-bromoazetidine-1-carboxylate 95% (CAS 939759-25-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A411454-100mg |
| cas | 939759-25-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1082.38 Pln | |
| Ambeed | 5g | 3162.75 Pln | |
| Ambeed | 10g | 4965.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A411454 |
Benzyl 3-bromoazetidine-1-carboxylate (CAS 939759-25-8) is a chemical compound with the molecular formula C11H12BrNO2 and a molecular weight of 270.12 g/mol. IUPAC name: benzyl 3-bromoazetidine-1-carboxylate. InChIKey: SUBBMOROFINEHA-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO2 |
|---|---|
| Molecular weight | 270.12 g/mol |
| IUPAC name | benzyl 3-bromoazetidine-1-carboxylate |
| InChIKey | SUBBMOROFINEHA-UHFFFAOYSA-N |
| SMILES | C1C(CN1C(=O)OCC2=CC=CC=C2)Br |
Computed by PubChem (NCBI)