cas: 220212-12-4 — see every product listed under this CAS number, including other names
Benzyl 3-bromopyrrolidine-1-carboxylate, 97%, 97% (CAS 220212-12-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJF0-100mg |
| cas | 220212-12-4 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 275.60 Pln | |
| Chemat | 5g | 765.20 Pln | |
| Chemat | 10g | 1254.80 Pln | |
| Chemat | 25g | 2450.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Benzyl 3-bromopyrrolidine-1-carboxylate (CAS 220212-12-4) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: benzyl 3-bromopyrrolidine-1-carboxylate. InChIKey: LWEKWWHCQBWMQC-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | benzyl 3-bromopyrrolidine-1-carboxylate |
| InChIKey | LWEKWWHCQBWMQC-UHFFFAOYSA-N |
| SMILES | C1CN(CC1Br)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)