CAS 276677-17-9 is the registry number for Methanone, (4-bromo-2-methylphenyl)-4-morpholinyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(4-bromo-2-methylphenyl)-morpholin-4-ylmethanone (CAS 276677-17-9) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: (4-bromo-2-methylphenyl)-morpholin-4-ylmethanone. InChIKey: VLLKGCWVHHBZTR-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | (4-bromo-2-methylphenyl)-morpholin-4-ylmethanone |
| InChIKey | VLLKGCWVHHBZTR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C(=O)N2CCOCC2 |
Computed by PubChem (NCBI)